C19H24N6O3S — CID 9147586
1-cyclopentyl-3-[[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]amino]thiourea (PubChem CID 9147586) has the molecular formula C19H24N6O3S and a molecular weight of 416.51 g/mol. Its IUPAC name is 1-cyclopentyl-3-[[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]amino]thiourea.
| Compound Name | 1-cyclopentyl-3-[[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]amino]thiourea |
|---|---|
| PubChem CID | 9147586 |
| Molecular Formula | C19H24N6O3S |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 1-cyclopentyl-3-[[4-[(3,5-dimethyl-4-nitropyrazol-1-yl)methyl]benzoyl]amino]thiourea |
| SMILES | Cc1nn(Cc2ccc(C(=O)NNC(=S)NC3CCCC3)cc2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H24N6O3S/c1-12-17(25(27)28)13(2)24(23-12)11-14-7-9-15(10-8-14)18(26)21-22-19(29)20-16-5-3-4-6-16/h7-10,16H,3-6,11H2,1-2H3,(H,21,26)(H2,20,22,29) |
| InChIKey | FUUWKKIKYZLZNP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|