C25H24FN6O2+ — CID 91476438
4-(4-fluorophenyl)-1-methyl-9-[[4-(4-methylimidazol-1-yl)-1,3-benzoxazol-7-yl]methylidene]-2,3,6,7-tetrahydro-[1,4]oxazino[4,3-b][1,2,4]triazin-1-ium (PubChem CID 91476438) has the molecular formula C25H24FN6O2+ and a molecular weight of 459.51 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1-methyl-9-[[4-(4-methylimidazol-1-yl)-1,3-benzoxazol-7-yl]methylidene]-2,3,6,7-tetrahydro-[1,4]oxazino[4,3-b][1,2,4]triazin-1-ium.
| Compound Name | 4-(4-fluorophenyl)-1-methyl-9-[[4-(4-methylimidazol-1-yl)-1,3-benzoxazol-7-yl]methylidene]-2,3,6,7-tetrahydro-[1,4]oxazino[4,3-b][1,2,4]triazin-1-ium |
|---|---|
| PubChem CID | 91476438 |
| Molecular Formula | C25H24FN6O2+ |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 4-(4-fluorophenyl)-1-methyl-9-[[4-(4-methylimidazol-1-yl)-1,3-benzoxazol-7-yl]methylidene]-2,3,6,7-tetrahydro-[1,4]oxazino[4,3-b][1,2,4]triazin-1-ium |
| SMILES | Cc1cn(-c2ccc(C=C3OCCN4C3=[N+](C)CCN4c3ccc(F)cc3)c3ocnc23)cn1 |
| InChI | InChI=1S/C25H24FN6O2/c1-17-14-30(15-27-17)21-8-3-18(24-23(21)28-16-34-24)13-22-25-29(2)9-10-31(32(25)11-12-33-22)20-6-4-19(26)5-7-20/h3-8,13-16H,9-12H2,1-2H3/q+1 |
| InChIKey | QVYOQFAGVOGDHF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 62.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|