C27H30N6O2Si — CID 46199656
trimethyl-[4-[(9Z)-9-[[4-(4-methylimidazol-1-yl)-1,3-benzoxazol-7-yl]methylidene]-2,3,6,7-tetrahydro-[1,4]oxazino[4,3-b][1,2,4]triazin-4-yl]phenyl]silane (PubChem CID 46199656) has the molecular formula C27H30N6O2Si and a molecular weight of 498.66 g/mol. Its IUPAC name is trimethyl-[4-[(9Z)-9-[[4-(4-methylimidazol-1-yl)-1,3-benzoxazol-7-yl]methylidene]-2,3,6,7-tetrahydro-[1,4]oxazino[4,3-b][1,2,4]triazin-4-yl]phenyl]silane.
| Compound Name | trimethyl-[4-[(9Z)-9-[[4-(4-methylimidazol-1-yl)-1,3-benzoxazol-7-yl]methylidene]-2,3,6,7-tetrahydro-[1,4]oxazino[4,3-b][1,2,4]triazin-4-yl]phenyl]silane |
|---|---|
| PubChem CID | 46199656 |
| Molecular Formula | C27H30N6O2Si |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | trimethyl-[4-[(9Z)-9-[[4-(4-methylimidazol-1-yl)-1,3-benzoxazol-7-yl]methylidene]-2,3,6,7-tetrahydro-[1,4]oxazino[4,3-b][1,2,4]triazin-4-yl]phenyl]silane |
| SMILES | Cc1cn(-c2ccc(/C=C3\OCCN4C3=NCCN4c3ccc([Si](C)(C)C)cc3)c3ocnc23)cn1 |
| InChI | InChI=1S/C27H30N6O2Si/c1-19-16-31(17-29-19)23-10-5-20(26-25(23)30-18-35-26)15-24-27-28-11-12-32(33(27)13-14-34-24)21-6-8-22(9-7-21)36(2,3)4/h5-10,15-18H,11-14H2,1-4H3/b24-15- |
| InChIKey | ZDVFYMSZVDHOQT-IWIPYMOSSA-N |
| XLogP | 4.37 |
| TPSA | 71.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|