C16H17N3O — CID 91478553
4-(hexa-2,4-dien-3-yldiazenyl)-N-prop-2-ynylbenzamide (PubChem CID 91478553) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is 4-(hexa-2,4-dien-3-yldiazenyl)-N-prop-2-ynylbenzamide.
| Compound Name | 4-(hexa-2,4-dien-3-yldiazenyl)-N-prop-2-ynylbenzamide |
|---|---|
| PubChem CID | 91478553 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 4-(hexa-2,4-dien-3-yldiazenyl)-N-prop-2-ynylbenzamide |
| SMILES | C#CCNC(=O)c1ccc(/N=N/C(C=CC)=CC)cc1 |
| InChI | InChI=1S/C16H17N3O/c1-4-7-14(6-3)18-19-15-10-8-13(9-11-15)16(20)17-12-5-2/h2,4,6-11H,12H2,1,3H3,(H,17,20)/b7-4?,14-6?,19-18+ |
| InChIKey | JTCCJKMBARRIHJ-WUTGLFOMSA-N |
| XLogP | 3.61 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|