C6H16O7P2 — CID 91479739
1-(1-dihydroxyphosphanyloxypropan-2-yloxy)propan-2-yl dihydrogen phosphite (PubChem CID 91479739) has the molecular formula C6H16O7P2 and a molecular weight of 262.13 g/mol. Its IUPAC name is 1-(1-dihydroxyphosphanyloxypropan-2-yloxy)propan-2-yl dihydrogen phosphite.
| Compound Name | 1-(1-dihydroxyphosphanyloxypropan-2-yloxy)propan-2-yl dihydrogen phosphite |
|---|---|
| PubChem CID | 91479739 |
| Molecular Formula | C6H16O7P2 |
| Molecular Weight | 262.13 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | 1-(1-dihydroxyphosphanyloxypropan-2-yloxy)propan-2-yl dihydrogen phosphite |
| SMILES | CC(COP(O)O)OCC(C)OP(O)O |
| InChI | InChI=1S/C6H16O7P2/c1-5(4-12-14(7)8)11-3-6(2)13-15(9)10/h5-10H,3-4H2,1-2H3 |
| InChIKey | BLBWIOVWIYTEIG-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.13 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|