C9H19ClO3 — CID 101356473
1-[1-(1-chloropropan-2-yloxy)propan-2-yloxy]propan-2-ol (PubChem CID 101356473) has the molecular formula C9H19ClO3 and a molecular weight of 210.70 g/mol. Its IUPAC name is 1-[1-(1-chloropropan-2-yloxy)propan-2-yloxy]propan-2-ol.
| Compound Name | 1-[1-(1-chloropropan-2-yloxy)propan-2-yloxy]propan-2-ol |
|---|---|
| PubChem CID | 101356473 |
| Molecular Formula | C9H19ClO3 |
| Molecular Weight | 210.70 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 1-[1-(1-chloropropan-2-yloxy)propan-2-yloxy]propan-2-ol |
| SMILES | CC(O)COC(C)COC(C)CCl |
| InChI | InChI=1S/C9H19ClO3/c1-7(11)5-12-9(3)6-13-8(2)4-10/h7-9,11H,4-6H2,1-3H3 |
| InChIKey | PEVSIBPMRMWDRD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.70 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|