C39H36N12 — CID 91480322
2-N,2-N,4-N,4-N,6-N,6-N-hexakis(pyridin-2-ylmethyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 91480322) has the molecular formula C39H36N12 and a molecular weight of 672.80 g/mol. Its IUPAC name is 2-N,2-N,4-N,4-N,6-N,6-N-hexakis(pyridin-2-ylmethyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N,4-N,4-N,6-N,6-N-hexakis(pyridin-2-ylmethyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 91480322 |
| Molecular Formula | C39H36N12 |
| Molecular Weight | 672.80 g/mol |
| Exact Mass | 672.32 |
| IUPAC Name | 2-N,2-N,4-N,4-N,6-N,6-N-hexakis(pyridin-2-ylmethyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | c1ccc(CN(Cc2ccccn2)c2nc(N(Cc3ccccn3)Cc3ccccn3)nc(N(Cc3ccccn3)Cc3ccccn3)n2)nc1 |
| InChI | InChI=1S/C39H36N12/c1-7-19-40-31(13-1)25-49(26-32-14-2-8-20-41-32)37-46-38(50(27-33-15-3-9-21-42-33)28-34-16-4-10-22-43-34)48-39(47-37)51(29-35-17-5-11-23-44-35)30-36-18-6-12-24-45-36/h1-24H,25-30H2 |
| InChIKey | QSWZEJFYRGTSKE-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 125.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.80 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |