C24H28BrN3O4 — CID 91481115
methyl N-[4-[2-[bromo-(4-phenylphenyl)carbamoyl]pyrrolidin-1-yl]-2-methyl-4-oxobutyl]carbamate (PubChem CID 91481115) has the molecular formula C24H28BrN3O4 and a molecular weight of 502.41 g/mol. Its IUPAC name is methyl N-[4-[2-[bromo-(4-phenylphenyl)carbamoyl]pyrrolidin-1-yl]-2-methyl-4-oxobutyl]carbamate.
| Compound Name | methyl N-[4-[2-[bromo-(4-phenylphenyl)carbamoyl]pyrrolidin-1-yl]-2-methyl-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 91481115 |
| Molecular Formula | C24H28BrN3O4 |
| Molecular Weight | 502.41 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | methyl N-[4-[2-[bromo-(4-phenylphenyl)carbamoyl]pyrrolidin-1-yl]-2-methyl-4-oxobutyl]carbamate |
| SMILES | COC(=O)NCC(C)CC(=O)N1CCCC1C(=O)N(Br)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H28BrN3O4/c1-17(16-26-24(31)32-2)15-22(29)27-14-6-9-21(27)23(30)28(25)20-12-10-19(11-13-20)18-7-4-3-5-8-18/h3-5,7-8,10-13,17,21H,6,9,14-16H2,1-2H3,(H,26,31) |
| InChIKey | YKLGMMVTOBBTBF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|