C10H8BrN3O — CID 914824
1-(2-bromophenyl)-2-(1,2,4-triazol-1-yl)ethanone (PubChem CID 914824) has the molecular formula C10H8BrN3O and a molecular weight of 266.10 g/mol. Its IUPAC name is 1-(2-bromophenyl)-2-(1,2,4-triazol-1-yl)ethanone.
| Compound Name | 1-(2-bromophenyl)-2-(1,2,4-triazol-1-yl)ethanone |
|---|---|
| PubChem CID | 914824 |
| Molecular Formula | C10H8BrN3O |
| Molecular Weight | 266.10 g/mol |
| Exact Mass | 264.99 |
| IUPAC Name | 1-(2-bromophenyl)-2-(1,2,4-triazol-1-yl)ethanone |
| SMILES | O=C(Cn1cncn1)c1ccccc1Br |
| InChI | InChI=1S/C10H8BrN3O/c11-9-4-2-1-3-8(9)10(15)5-14-7-12-6-13-14/h1-4,6-7H,5H2 |
| InChIKey | WXERDXJZOKCUPJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.10 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |