C25H31N5O5 — CID 91482992
4-[4-[3-[2-(1H-imidazol-2-yl)hydrazinyl]butyl]phenoxy]-2-(phenylmethoxycarbonylamino)butanoic acid (PubChem CID 91482992) has the molecular formula C25H31N5O5 and a molecular weight of 481.55 g/mol. Its IUPAC name is 4-[4-[3-[2-(1H-imidazol-2-yl)hydrazinyl]butyl]phenoxy]-2-(phenylmethoxycarbonylamino)butanoic acid.
| Compound Name | 4-[4-[3-[2-(1H-imidazol-2-yl)hydrazinyl]butyl]phenoxy]-2-(phenylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 91482992 |
| Molecular Formula | C25H31N5O5 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.23 |
| IUPAC Name | 4-[4-[3-[2-(1H-imidazol-2-yl)hydrazinyl]butyl]phenoxy]-2-(phenylmethoxycarbonylamino)butanoic acid |
| SMILES | CC(CCc1ccc(OCCC(NC(=O)OCc2ccccc2)C(=O)O)cc1)NNc1ncc[nH]1 |
| InChI | InChI=1S/C25H31N5O5/c1-18(29-30-24-26-14-15-27-24)7-8-19-9-11-21(12-10-19)34-16-13-22(23(31)32)28-25(33)35-17-20-5-3-2-4-6-20/h2-6,9-12,14-15,18,22,29H,7-8,13,16-17H2,1H3,(H,28,33)(H,31,32)(H2,26,27,30) |
| InChIKey | HRZNBPIVRMJZRV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 137.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|