C23H29N5O5 — CID 87880279
(2S)-4-[4-[3-(diaminomethylidenehydrazinylidene)butyl]phenoxy]-2-(phenylmethoxycarbonylamino)butanoic acid (PubChem CID 87880279) has the molecular formula C23H29N5O5 and a molecular weight of 455.52 g/mol. Its IUPAC name is (2S)-4-[4-[3-(diaminomethylidenehydrazinylidene)butyl]phenoxy]-2-(phenylmethoxycarbonylamino)butanoic acid.
| Compound Name | (2S)-4-[4-[3-(diaminomethylidenehydrazinylidene)butyl]phenoxy]-2-(phenylmethoxycarbonylamino)butanoic acid |
|---|---|
| PubChem CID | 87880279 |
| Molecular Formula | C23H29N5O5 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | (2S)-4-[4-[3-(diaminomethylidenehydrazinylidene)butyl]phenoxy]-2-(phenylmethoxycarbonylamino)butanoic acid |
| SMILES | CC(CCc1ccc(OCC[C@H](NC(=O)OCc2ccccc2)C(=O)O)cc1)=NN=C(N)N |
| InChI | InChI=1S/C23H29N5O5/c1-16(27-28-22(24)25)7-8-17-9-11-19(12-10-17)32-14-13-20(21(29)30)26-23(31)33-15-18-5-3-2-4-6-18/h2-6,9-12,20H,7-8,13-15H2,1H3,(H,26,31)(H,29,30)(H4,24,25,28)/t20-/m0/s1 |
| InChIKey | SSWUZDFNBSYUNX-FQEVSTJZSA-N |
| XLogP | 2.42 |
| TPSA | 161.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|