C14H18N2O3 — CID 91483530
3-[(2-propan-2-yloxyphenyl)diazenyl]pentane-2,4-dione (PubChem CID 91483530) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 3-[(2-propan-2-yloxyphenyl)diazenyl]pentane-2,4-dione.
| Compound Name | 3-[(2-propan-2-yloxyphenyl)diazenyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 91483530 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 3-[(2-propan-2-yloxyphenyl)diazenyl]pentane-2,4-dione |
| SMILES | CC(=O)C(/N=N/c1ccccc1OC(C)C)C(C)=O |
| InChI | InChI=1S/C14H18N2O3/c1-9(2)19-13-8-6-5-7-12(13)15-16-14(10(3)17)11(4)18/h5-9,14H,1-4H3/b16-15+ |
| InChIKey | QTVLNUPFTQFXFY-FOCLMDBBSA-N |
| XLogP | 3.10 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|