C14H15F3N2O3 — CID 90848988
5,5,5-trifluoro-4-imino-2-(2-propan-2-yloxyphenyl)iminopentanoic acid (PubChem CID 90848988) has the molecular formula C14H15F3N2O3 and a molecular weight of 316.28 g/mol. Its IUPAC name is 5,5,5-trifluoro-4-imino-2-(2-propan-2-yloxyphenyl)iminopentanoic acid.
| Compound Name | 5,5,5-trifluoro-4-imino-2-(2-propan-2-yloxyphenyl)iminopentanoic acid |
|---|---|
| PubChem CID | 90848988 |
| Molecular Formula | C14H15F3N2O3 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 5,5,5-trifluoro-4-imino-2-(2-propan-2-yloxyphenyl)iminopentanoic acid |
| SMILES | [H]/N=C(/C/C(=N/c1ccccc1OC(C)C)C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C14H15F3N2O3/c1-8(2)22-11-6-4-3-5-9(11)19-10(13(20)21)7-12(18)14(15,16)17/h3-6,8,18H,7H2,1-2H3,(H,20,21)/b18-12-,19-10- |
| InChIKey | NAELWKHMFFFDME-BYNIGHJWSA-N |
| XLogP | 3.60 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|