C24H44 — CID 91483698
1-methyl-2-(2,5,6,7-tetramethyl-2-propan-2-yl-4-propyldeca-5,7-dienyl)cyclopropane (PubChem CID 91483698) has the molecular formula C24H44 and a molecular weight of 332.62 g/mol. Its IUPAC name is 1-methyl-2-(2,5,6,7-tetramethyl-2-propan-2-yl-4-propyldeca-5,7-dienyl)cyclopropane.
| Compound Name | 1-methyl-2-(2,5,6,7-tetramethyl-2-propan-2-yl-4-propyldeca-5,7-dienyl)cyclopropane |
|---|---|
| PubChem CID | 91483698 |
| Molecular Formula | C24H44 |
| Molecular Weight | 332.62 g/mol |
| Exact Mass | 332.34 |
| IUPAC Name | 1-methyl-2-(2,5,6,7-tetramethyl-2-propan-2-yl-4-propyldeca-5,7-dienyl)cyclopropane |
| SMILES | CCC=C(C)C(C)=C(C)C(CCC)CC(C)(CC1CC1C)C(C)C |
| InChI | InChI=1S/C24H44/c1-10-12-18(5)20(7)21(8)22(13-11-2)15-24(9,17(3)4)16-23-14-19(23)6/h12,17,19,22-23H,10-11,13-16H2,1-9H3 |
| InChIKey | VKBGCQGRUSGHDL-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.62 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|