About 1-O-butyl 4-O-chloro 2-butyl-3-chlorobut-2-enedioate
1-O-butyl 4-O-chloro 2-butyl-3-chlorobut-2-enedioate (PubChem CID 91483802) has the molecular formula C12H18Cl2O4
and a molecular weight of 297.18 g/mol. Its IUPAC name is 1-O-butyl 4-O-chloro 2-butyl-3-chlorobut-2-enedioate.
Molecular Properties
| Compound Name | 1-O-butyl 4-O-chloro 2-butyl-3-chlorobut-2-enedioate |
| PubChem CID | 91483802 |
| Molecular Formula | C12H18Cl2O4 |
| Molecular Weight | 297.18 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 1-O-butyl 4-O-chloro 2-butyl-3-chlorobut-2-enedioate |
| SMILES | CCCCOC(=O)C(CCCC)=C(Cl)C(=O)OCl |
| InChI | InChI=1S/C12H18Cl2O4/c1-3-5-7-9(10(13)12(16)18-14)11(15)17-8-6-4-2/h3-8H2,1-2H3 |
| InChIKey | QISWWRBOLDYHMC-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.18 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-O-butyl 4-O-chloro 2-butyl-3-chlorobut-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-butyl 4-O-chloro 2-butyl-3-chlorobut-2-enedioate?
The IUPAC name of 1-O-butyl 4-O-chloro 2-butyl-3-chlorobut-2-enedioate (CID 91483802) is 1-O-butyl 4-O-chloro 2-butyl-3-chlorobut-2-enedioate.
What is the SMILES notation for 1-O-butyl 4-O-chloro 2-butyl-3-chlorobut-2-enedioate?
The canonical SMILES for 1-O-butyl 4-O-chloro 2-butyl-3-chlorobut-2-enedioate is CCCCOC(=O)C(CCCC)=C(Cl)C(=O)OCl.
What is the InChIKey of 1-O-butyl 4-O-chloro 2-butyl-3-chlorobut-2-enedioate?
The InChIKey is QISWWRBOLDYHMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18Cl2O4/c1-3-5-7-9(10(13)12(16)18-14)11(15)17-8-6-4-2/h3-8H2,1-2H3.
What are the key properties of 1-O-butyl 4-O-chloro 2-butyl-3-chlorobut-2-enedioate?
1-O-butyl 4-O-chloro 2-butyl-3-chlorobut-2-enedioate has a molecular weight of 297.18 g/mol, XLogP of 3.71, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-butyl 4-O-chloro 2-butyl-3-chlorobut-2-enedioate is sourced from PubChem (CID 91483802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).