C24H27N3O4 — CID 91484352
(4-hydroxypiperidin-1-yl)-[4-(methoxyamino)-1-(4-phenylbenzoyl)-2,3-dihydropyrrol-2-yl]methanone (PubChem CID 91484352) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is (4-hydroxypiperidin-1-yl)-[4-(methoxyamino)-1-(4-phenylbenzoyl)-2,3-dihydropyrrol-2-yl]methanone.
| Compound Name | (4-hydroxypiperidin-1-yl)-[4-(methoxyamino)-1-(4-phenylbenzoyl)-2,3-dihydropyrrol-2-yl]methanone |
|---|---|
| PubChem CID | 91484352 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | (4-hydroxypiperidin-1-yl)-[4-(methoxyamino)-1-(4-phenylbenzoyl)-2,3-dihydropyrrol-2-yl]methanone |
| SMILES | CONC1=CN(C(=O)c2ccc(-c3ccccc3)cc2)C(C(=O)N2CCC(O)CC2)C1 |
| InChI | InChI=1S/C24H27N3O4/c1-31-25-20-15-22(24(30)26-13-11-21(28)12-14-26)27(16-20)23(29)19-9-7-18(8-10-19)17-5-3-2-4-6-17/h2-10,16,21-22,25,28H,11-15H2,1H3 |
| InChIKey | XKKCCHCBRWBZMP-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|