C27H29N5O4 — CID 90893979
1-[4-[3-[4-(methoxyamino)-1-(4-phenylbenzoyl)-2,3-dihydropyrrol-2-yl]-1,2,4-oxadiazol-5-yl]piperidin-1-yl]ethanone (PubChem CID 90893979) has the molecular formula C27H29N5O4 and a molecular weight of 487.56 g/mol. Its IUPAC name is 1-[4-[3-[4-(methoxyamino)-1-(4-phenylbenzoyl)-2,3-dihydropyrrol-2-yl]-1,2,4-oxadiazol-5-yl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[3-[4-(methoxyamino)-1-(4-phenylbenzoyl)-2,3-dihydropyrrol-2-yl]-1,2,4-oxadiazol-5-yl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 90893979 |
| Molecular Formula | C27H29N5O4 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | 1-[4-[3-[4-(methoxyamino)-1-(4-phenylbenzoyl)-2,3-dihydropyrrol-2-yl]-1,2,4-oxadiazol-5-yl]piperidin-1-yl]ethanone |
| SMILES | CONC1=CN(C(=O)c2ccc(-c3ccccc3)cc2)C(c2noc(C3CCN(C(C)=O)CC3)n2)C1 |
| InChI | InChI=1S/C27H29N5O4/c1-18(33)31-14-12-21(13-15-31)26-28-25(30-36-26)24-16-23(29-35-2)17-32(24)27(34)22-10-8-20(9-11-22)19-6-4-3-5-7-19/h3-11,17,21,24,29H,12-16H2,1-2H3 |
| InChIKey | LJYKGMNQOBZYQG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|