C27H24N4O4 — CID 91167290
[4-(methoxyamino)-2-[5-(phenoxymethyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydropyrrol-1-yl]-(4-phenylphenyl)methanone (PubChem CID 91167290) has the molecular formula C27H24N4O4 and a molecular weight of 468.51 g/mol. Its IUPAC name is [4-(methoxyamino)-2-[5-(phenoxymethyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydropyrrol-1-yl]-(4-phenylphenyl)methanone.
| Compound Name | [4-(methoxyamino)-2-[5-(phenoxymethyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydropyrrol-1-yl]-(4-phenylphenyl)methanone |
|---|---|
| PubChem CID | 91167290 |
| Molecular Formula | C27H24N4O4 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | [4-(methoxyamino)-2-[5-(phenoxymethyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydropyrrol-1-yl]-(4-phenylphenyl)methanone |
| SMILES | CONC1=CN(C(=O)c2ccc(-c3ccccc3)cc2)C(c2noc(COc3ccccc3)n2)C1 |
| InChI | InChI=1S/C27H24N4O4/c1-33-29-22-16-24(26-28-25(35-30-26)18-34-23-10-6-3-7-11-23)31(17-22)27(32)21-14-12-20(13-15-21)19-8-4-2-5-9-19/h2-15,17,24,29H,16,18H2,1H3 |
| InChIKey | PQUJGESEBAXHAQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|