C25H26N4O3 — CID 91190972
[2-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)-4-(methoxyamino)-2,3-dihydropyrrol-1-yl]-(4-phenylphenyl)methanone (PubChem CID 91190972) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is [2-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)-4-(methoxyamino)-2,3-dihydropyrrol-1-yl]-(4-phenylphenyl)methanone.
| Compound Name | [2-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)-4-(methoxyamino)-2,3-dihydropyrrol-1-yl]-(4-phenylphenyl)methanone |
|---|---|
| PubChem CID | 91190972 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | [2-(5-cyclopentyl-1,2,4-oxadiazol-3-yl)-4-(methoxyamino)-2,3-dihydropyrrol-1-yl]-(4-phenylphenyl)methanone |
| SMILES | CONC1=CN(C(=O)c2ccc(-c3ccccc3)cc2)C(c2noc(C3CCCC3)n2)C1 |
| InChI | InChI=1S/C25H26N4O3/c1-31-27-21-15-22(23-26-24(32-28-23)19-9-5-6-10-19)29(16-21)25(30)20-13-11-18(12-14-20)17-7-3-2-4-8-17/h2-4,7-8,11-14,16,19,22,27H,5-6,9-10,15H2,1H3 |
| InChIKey | IEKSFRNZXNDVQB-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|