C10H13N3O5S — CID 91484411
1-(2-methoxy-5-nitrophenyl)-3-(methyl-methylidene-oxo-λ6-sulfanyl)urea (PubChem CID 91484411) has the molecular formula C10H13N3O5S and a molecular weight of 287.30 g/mol. Its IUPAC name is 1-(2-methoxy-5-nitrophenyl)-3-(methyl-methylidene-oxo-λ6-sulfanyl)urea.
| Compound Name | 1-(2-methoxy-5-nitrophenyl)-3-(methyl-methylidene-oxo-λ6-sulfanyl)urea |
|---|---|
| PubChem CID | 91484411 |
| Molecular Formula | C10H13N3O5S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 1-(2-methoxy-5-nitrophenyl)-3-(methyl-methylidene-oxo-λ6-sulfanyl)urea |
| SMILES | C=S(C)(=O)NC(=O)Nc1cc([N+](=O)[O-])ccc1OC |
| InChI | InChI=1S/C10H13N3O5S/c1-18-9-5-4-7(13(15)16)6-8(9)11-10(14)12-19(2,3)17/h4-6H,2H2,1,3H3,(H2,11,12,14,17) |
| InChIKey | CTWRQYDMCZPYNV-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|