C9H13N — CID 91484682
2,3-dimethyl-4,5-dihydroazocine (PubChem CID 91484682) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is 2,3-dimethyl-4,5-dihydroazocine.
| Compound Name | 2,3-dimethyl-4,5-dihydroazocine |
|---|---|
| PubChem CID | 91484682 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 2,3-dimethyl-4,5-dihydroazocine |
| SMILES | CC1=C(C)/N=C\C=CCC1 |
| InChI | InChI=1S/C9H13N/c1-8-6-4-3-5-7-10-9(8)2/h3,5,7H,4,6H2,1-2H3/b5-3?,9-8?,10-7- |
| InChIKey | IDPVONIBFZLKKU-IWGMCCQJSA-N |
| XLogP | 2.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |