C20H26N3+ — CID 91484782
2-(3,6-diethyl-1,4,5-trimethylpyridin-1-ium-2-yl)-1-methylbenzimidazole (PubChem CID 91484782) has the molecular formula C20H26N3+ and a molecular weight of 308.45 g/mol. Its IUPAC name is 2-(3,6-diethyl-1,4,5-trimethylpyridin-1-ium-2-yl)-1-methylbenzimidazole.
| Compound Name | 2-(3,6-diethyl-1,4,5-trimethylpyridin-1-ium-2-yl)-1-methylbenzimidazole |
|---|---|
| PubChem CID | 91484782 |
| Molecular Formula | C20H26N3+ |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 2-(3,6-diethyl-1,4,5-trimethylpyridin-1-ium-2-yl)-1-methylbenzimidazole |
| SMILES | CCc1c(C)c(C)c(CC)[n+](C)c1-c1nc2ccccc2n1C |
| InChI | InChI=1S/C20H26N3/c1-7-15-13(3)14(4)17(8-2)22(5)19(15)20-21-16-11-9-10-12-18(16)23(20)6/h9-12H,7-8H2,1-6H3/q+1 |
| InChIKey | YOTSXIAQPOFAFP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|