C11H21NO — CID 91485538
4-(2,3-dimethylbutyl)-5-azabicyclo[2.1.1]hexan-1-ol (PubChem CID 91485538) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 4-(2,3-dimethylbutyl)-5-azabicyclo[2.1.1]hexan-1-ol.
| Compound Name | 4-(2,3-dimethylbutyl)-5-azabicyclo[2.1.1]hexan-1-ol |
|---|---|
| PubChem CID | 91485538 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 4-(2,3-dimethylbutyl)-5-azabicyclo[2.1.1]hexan-1-ol |
| SMILES | CC(C)C(C)CC12CCC(O)(C1)N2 |
| InChI | InChI=1S/C11H21NO/c1-8(2)9(3)6-10-4-5-11(13,7-10)12-10/h8-9,12-13H,4-7H2,1-3H3 |
| InChIKey | KXTSKCHEIUAQQX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |