C16H17F15O3 — CID 91486381
8-ethenoxy-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluorooctane;methoxyethene (PubChem CID 91486381) has the molecular formula C16H17F15O3 and a molecular weight of 542.28 g/mol. Its IUPAC name is 8-ethenoxy-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluorooctane;methoxyethene.
| Compound Name | 8-ethenoxy-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluorooctane;methoxyethene |
|---|---|
| PubChem CID | 91486381 |
| Molecular Formula | C16H17F15O3 |
| Molecular Weight | 542.28 g/mol |
| Exact Mass | 542.09 |
| IUPAC Name | 8-ethenoxy-1,1,1,2,2,3,3,4,4,5,5,6,6,7,7-pentadecafluorooctane;methoxyethene |
| SMILES | C=COC.C=COC.C=COCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H5F15O.2C3H6O/c1-2-26-3-4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)9(21,22)10(23,24)25;2*1-3-4-2/h2H,1,3H2;2*3H,1H2,2H3 |
| InChIKey | SMTHRWRWXGDGHG-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.28 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|