About phenyl 2-methylbenzoate;phenyl 2-[(2-methylpropan-2-yl)oxymethoxy]benzoate
phenyl 2-methylbenzoate;phenyl 2-[(2-methylpropan-2-yl)oxymethoxy]benzoate (PubChem CID 91489741) has the molecular formula C32H32O6
and a molecular weight of 512.60 g/mol. Its IUPAC name is phenyl 2-methylbenzoate;phenyl 2-[(2-methylpropan-2-yl)oxymethoxy]benzoate.
Molecular Properties
| Compound Name | phenyl 2-methylbenzoate;phenyl 2-[(2-methylpropan-2-yl)oxymethoxy]benzoate |
| PubChem CID | 91489741 |
| Molecular Formula | C32H32O6 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | phenyl 2-methylbenzoate;phenyl 2-[(2-methylpropan-2-yl)oxymethoxy]benzoate |
| SMILES | CC(C)(C)OCOc1ccccc1C(=O)Oc1ccccc1.Cc1ccccc1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C18H20O4.C14H12O2/c1-18(2,3)21-13-20-16-12-8-7-11-15(16)17(19)22-14-9-5-4-6-10-14;1-11-7-5-6-10-13(11)14(15)16-12-8-3-2-4-9-12/h4-12H,13H2,1-3H3;2-10H,1H3 |
| InChIKey | QUISNLOMPPPDCY-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 2-methylbenzoate;phenyl 2-[(2-methylpropan-2-yl)oxymethoxy]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 2-methylbenzoate;phenyl 2-[(2-methylpropan-2-yl)oxymethoxy]benzoate?
The IUPAC name of phenyl 2-methylbenzoate;phenyl 2-[(2-methylpropan-2-yl)oxymethoxy]benzoate (CID 91489741) is phenyl 2-methylbenzoate;phenyl 2-[(2-methylpropan-2-yl)oxymethoxy]benzoate.
What is the SMILES notation for phenyl 2-methylbenzoate;phenyl 2-[(2-methylpropan-2-yl)oxymethoxy]benzoate?
The canonical SMILES for phenyl 2-methylbenzoate;phenyl 2-[(2-methylpropan-2-yl)oxymethoxy]benzoate is CC(C)(C)OCOc1ccccc1C(=O)Oc1ccccc1.Cc1ccccc1C(=O)Oc1ccccc1.
What is the InChIKey of phenyl 2-methylbenzoate;phenyl 2-[(2-methylpropan-2-yl)oxymethoxy]benzoate?
The InChIKey is QUISNLOMPPPDCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20O4.C14H12O2/c1-18(2,3)21-13-20-16-12-8-7-11-15(16)17(19)22-14-9-5-4-6-10-14;1-11-7-5-6-10-13(11)14(15)16-12-8-3-2-4-9-12/h4-12H,13H2,1-3H3;2-10H,1H3.
What are the key properties of phenyl 2-methylbenzoate;phenyl 2-[(2-methylpropan-2-yl)oxymethoxy]benzoate?
phenyl 2-methylbenzoate;phenyl 2-[(2-methylpropan-2-yl)oxymethoxy]benzoate has a molecular weight of 512.60 g/mol, XLogP of 7.27, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 2-methylbenzoate;phenyl 2-[(2-methylpropan-2-yl)oxymethoxy]benzoate is sourced from PubChem (CID 91489741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).