C9H14N2 — CID 91494697
2-ethyl-2,6-dimethyl-1,4-diazepine (PubChem CID 91494697) has the molecular formula C9H14N2 and a molecular weight of 150.22 g/mol. Its IUPAC name is 2-ethyl-2,6-dimethyl-1,4-diazepine.
| Compound Name | 2-ethyl-2,6-dimethyl-1,4-diazepine |
|---|---|
| PubChem CID | 91494697 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | 2-ethyl-2,6-dimethyl-1,4-diazepine |
| SMILES | CCC1(C)C=NC=C(C)C=N1 |
| InChI | InChI=1S/C9H14N2/c1-4-9(3)7-10-5-8(2)6-11-9/h5-7H,4H2,1-3H3 |
| InChIKey | DUHAAZZKJLWSFQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |