About 6-propan-2-yl-1,4-diazacyclohepta-2,3,5,7-tetraene
6-propan-2-yl-1,4-diazacyclohepta-2,3,5,7-tetraene (PubChem CID 129103305) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is 6-propan-2-yl-1,4-diazacyclohepta-2,3,5,7-tetraene.
Analyze 6-propan-2-yl-1,4-diazacyclohepta-2,3,5,7-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propan-2-yl-1,4-diazacyclohepta-2,3,5,7-tetraene?
The IUPAC name of 6-propan-2-yl-1,4-diazacyclohepta-2,3,5,7-tetraene (CID 129103305) is 6-propan-2-yl-1,4-diazacyclohepta-2,3,5,7-tetraene.
What is the SMILES notation for 6-propan-2-yl-1,4-diazacyclohepta-2,3,5,7-tetraene?
The canonical SMILES for 6-propan-2-yl-1,4-diazacyclohepta-2,3,5,7-tetraene is CC(C)C1=CN=C=CN=C1.
What is the InChIKey of 6-propan-2-yl-1,4-diazacyclohepta-2,3,5,7-tetraene?
The InChIKey is NYNIKWCDVQFNSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2/c1-7(2)8-5-9-3-4-10-6-8/h3,5-7H,1-2H3.
What are the key properties of 6-propan-2-yl-1,4-diazacyclohepta-2,3,5,7-tetraene?
6-propan-2-yl-1,4-diazacyclohepta-2,3,5,7-tetraene has a molecular weight of 134.18 g/mol, XLogP of 1.79, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propan-2-yl-1,4-diazacyclohepta-2,3,5,7-tetraene is sourced from PubChem (CID 129103305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).