C24H27ClN2O5 — CID 91497991
2-(1,3-benzoxazol-2-yl)-N-(2-chloro-5-methylphenyl)acetamide;ethyl 3-ethoxybut-3-enoate (PubChem CID 91497991) has the molecular formula C24H27ClN2O5 and a molecular weight of 458.94 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)-N-(2-chloro-5-methylphenyl)acetamide;ethyl 3-ethoxybut-3-enoate.
| Compound Name | 2-(1,3-benzoxazol-2-yl)-N-(2-chloro-5-methylphenyl)acetamide;ethyl 3-ethoxybut-3-enoate |
|---|---|
| PubChem CID | 91497991 |
| Molecular Formula | C24H27ClN2O5 |
| Molecular Weight | 458.94 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)-N-(2-chloro-5-methylphenyl)acetamide;ethyl 3-ethoxybut-3-enoate |
| SMILES | C=C(CC(=O)OCC)OCC.Cc1ccc(Cl)c(NC(=O)Cc2nc3ccccc3o2)c1 |
| InChI | InChI=1S/C16H13ClN2O2.C8H14O3/c1-10-6-7-11(17)13(8-10)18-15(20)9-16-19-12-4-2-3-5-14(12)21-16;1-4-10-7(3)6-8(9)11-5-2/h2-8H,9H2,1H3,(H,18,20);3-6H2,1-2H3 |
| InChIKey | JQBFCWZWXVRHKL-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.94 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|