C13H6F3N2O5S+ — CID 91498231
(5,6-dioxo-1,10-phenanthrolin-1-ium-1-yl) trifluoromethanesulfonate (PubChem CID 91498231) has the molecular formula C13H6F3N2O5S+ and a molecular weight of 359.26 g/mol. Its IUPAC name is (5,6-dioxo-1,10-phenanthrolin-1-ium-1-yl) trifluoromethanesulfonate.
| Compound Name | (5,6-dioxo-1,10-phenanthrolin-1-ium-1-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 91498231 |
| Molecular Formula | C13H6F3N2O5S+ |
| Molecular Weight | 359.26 g/mol |
| Exact Mass | 358.99 |
| IUPAC Name | (5,6-dioxo-1,10-phenanthrolin-1-ium-1-yl) trifluoromethanesulfonate |
| SMILES | O=C1C(=O)c2ccc[n+](OS(=O)(=O)C(F)(F)F)c2-c2ncccc21 |
| InChI | InChI=1S/C13H6F3N2O5S/c14-13(15,16)24(21,22)23-18-6-2-4-8-10(18)9-7(3-1-5-17-9)11(19)12(8)20/h1-6H/q+1 |
| InChIKey | IYERSGCWJFWSNQ-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 94.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.26 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|