C23H33BrN3O4+ — CID 91502703
tert-butyl N-[1-[2-(7-bromo-2-methoxyquinolin-8-yl)-3-hydroxypropyl]piperidin-1-ium-1-yl]carbamate (PubChem CID 91502703) has the molecular formula C23H33BrN3O4+ and a molecular weight of 495.44 g/mol. Its IUPAC name is tert-butyl N-[1-[2-(7-bromo-2-methoxyquinolin-8-yl)-3-hydroxypropyl]piperidin-1-ium-1-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-(7-bromo-2-methoxyquinolin-8-yl)-3-hydroxypropyl]piperidin-1-ium-1-yl]carbamate |
|---|---|
| PubChem CID | 91502703 |
| Molecular Formula | C23H33BrN3O4+ |
| Molecular Weight | 495.44 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | tert-butyl N-[1-[2-(7-bromo-2-methoxyquinolin-8-yl)-3-hydroxypropyl]piperidin-1-ium-1-yl]carbamate |
| SMILES | COc1ccc2ccc(Br)c(C(CO)C[N+]3(NC(=O)OC(C)(C)C)CCCCC3)c2n1 |
| InChI | InChI=1S/C23H32BrN3O4/c1-23(2,3)31-22(29)26-27(12-6-5-7-13-27)14-17(15-28)20-18(24)10-8-16-9-11-19(30-4)25-21(16)20/h8-11,17,28H,5-7,12-15H2,1-4H3/p+1 |
| InChIKey | TZMRJPJTWIYIBR-UHFFFAOYSA-O |
| XLogP | 4.52 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|