C10H15N — CID 91504685
3,7-diethyl-4H-azepine (PubChem CID 91504685) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 3,7-diethyl-4H-azepine.
| Compound Name | 3,7-diethyl-4H-azepine |
|---|---|
| PubChem CID | 91504685 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 3,7-diethyl-4H-azepine |
| SMILES | CCC1=CN=C(CC)C=CC1 |
| InChI | InChI=1S/C10H15N/c1-3-9-6-5-7-10(4-2)11-8-9/h5,7-8H,3-4,6H2,1-2H3 |
| InChIKey | JBTODDIVXXVSMW-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |