C22H27N3O4S — CID 91504901
N-(1-cyanopyrrolidin-3-yl)-N-[(3,5-dimethylphenyl)methyl]-2,5-dimethoxybenzenesulfonamide (PubChem CID 91504901) has the molecular formula C22H27N3O4S and a molecular weight of 429.54 g/mol. Its IUPAC name is N-(1-cyanopyrrolidin-3-yl)-N-[(3,5-dimethylphenyl)methyl]-2,5-dimethoxybenzenesulfonamide.
| Compound Name | N-(1-cyanopyrrolidin-3-yl)-N-[(3,5-dimethylphenyl)methyl]-2,5-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 91504901 |
| Molecular Formula | C22H27N3O4S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | N-(1-cyanopyrrolidin-3-yl)-N-[(3,5-dimethylphenyl)methyl]-2,5-dimethoxybenzenesulfonamide |
| SMILES | COc1ccc(OC)c(S(=O)(=O)N(Cc2cc(C)cc(C)c2)C2CCN(C#N)C2)c1 |
| InChI | InChI=1S/C22H27N3O4S/c1-16-9-17(2)11-18(10-16)13-25(19-7-8-24(14-19)15-23)30(26,27)22-12-20(28-3)5-6-21(22)29-4/h5-6,9-12,19H,7-8,13-14H2,1-4H3 |
| InChIKey | UORNTGHOCSSOTC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|