C25H33BrN2O2 — CID 91505346
2-bromo-5-[1-(3,4-dimethoxyphenyl)-2-pyridin-4-ylpropyl]pyridine;ethane (PubChem CID 91505346) has the molecular formula C25H33BrN2O2 and a molecular weight of 473.46 g/mol. Its IUPAC name is 2-bromo-5-[1-(3,4-dimethoxyphenyl)-2-pyridin-4-ylpropyl]pyridine;ethane.
| Compound Name | 2-bromo-5-[1-(3,4-dimethoxyphenyl)-2-pyridin-4-ylpropyl]pyridine;ethane |
|---|---|
| PubChem CID | 91505346 |
| Molecular Formula | C25H33BrN2O2 |
| Molecular Weight | 473.46 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 2-bromo-5-[1-(3,4-dimethoxyphenyl)-2-pyridin-4-ylpropyl]pyridine;ethane |
| SMILES | CC.CC.COc1ccc(C(c2ccc(Br)nc2)C(C)c2ccncc2)cc1OC |
| InChI | InChI=1S/C21H21BrN2O2.2C2H6/c1-14(15-8-10-23-11-9-15)21(17-5-7-20(22)24-13-17)16-4-6-18(25-2)19(12-16)26-3;2*1-2/h4-14,21H,1-3H3;2*1-2H3 |
| InChIKey | XQGSHWFFWPOFNZ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.46 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|