C20H26O4 — CID 91505862
(1S,6S,8S)-3,8,16-trimethyl-17-oxo-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-triene-12-carbaldehyde (PubChem CID 91505862) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is (1S,6S,8S)-3,8,16-trimethyl-17-oxo-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-triene-12-carbaldehyde.
| Compound Name | (1S,6S,8S)-3,8,16-trimethyl-17-oxo-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-triene-12-carbaldehyde |
|---|---|
| PubChem CID | 91505862 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (1S,6S,8S)-3,8,16-trimethyl-17-oxo-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-triene-12-carbaldehyde |
| SMILES | CC1=C[C@@H]2OC(=O)C(C)=C2CCC(C=O)=CCC[C@]2(C)O[C@H]2CC1 |
| InChI | InChI=1S/C20H26O4/c1-13-6-9-18-20(3,24-18)10-4-5-15(12-21)7-8-16-14(2)19(22)23-17(16)11-13/h5,11-12,17-18H,4,6-10H2,1-3H3/t17-,18-,20-/m0/s1 |
| InChIKey | GBVIWXZUPMCCRB-BJLQDIEVSA-N |
| XLogP | 3.81 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|