C19H20N2O4S — CID 91506487
(2R)-2-(N-[2-[(2-phenylacetyl)amino]acetyl]anilino)-3-sulfanylpropanoic acid (PubChem CID 91506487) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is (2R)-2-(N-[2-[(2-phenylacetyl)amino]acetyl]anilino)-3-sulfanylpropanoic acid.
| Compound Name | (2R)-2-(N-[2-[(2-phenylacetyl)amino]acetyl]anilino)-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 91506487 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | (2R)-2-(N-[2-[(2-phenylacetyl)amino]acetyl]anilino)-3-sulfanylpropanoic acid |
| SMILES | O=C(Cc1ccccc1)NCC(=O)N(c1ccccc1)[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C19H20N2O4S/c22-17(11-14-7-3-1-4-8-14)20-12-18(23)21(16(13-26)19(24)25)15-9-5-2-6-10-15/h1-10,16,26H,11-13H2,(H,20,22)(H,24,25)/t16-/m0/s1 |
| InChIKey | GBSHTVDNMCZERG-INIZCTEOSA-N |
| XLogP | 1.76 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|