C31H42O6S — CID 91507757
O-[2-[(2R,5R,17S,18S,20S)-5-cyclohexyl-20-hydroxy-2,18-dimethyl-8-oxo-4,6-dioxapentacyclo[11.7.0.02,10.03,7.014,18]icosa-3(7),9-dien-17-yl]-2-oxoethyl] propanethioate (PubChem CID 91507757) has the molecular formula C31H42O6S and a molecular weight of 542.74 g/mol. Its IUPAC name is O-[2-[(2R,5R,17S,18S,20S)-5-cyclohexyl-20-hydroxy-2,18-dimethyl-8-oxo-4,6-dioxapentacyclo[11.7.0.02,10.03,7.014,18]icosa-3(7),9-dien-17-yl]-2-oxoethyl] propanethioate.
| Compound Name | O-[2-[(2R,5R,17S,18S,20S)-5-cyclohexyl-20-hydroxy-2,18-dimethyl-8-oxo-4,6-dioxapentacyclo[11.7.0.02,10.03,7.014,18]icosa-3(7),9-dien-17-yl]-2-oxoethyl] propanethioate |
|---|---|
| PubChem CID | 91507757 |
| Molecular Formula | C31H42O6S |
| Molecular Weight | 542.74 g/mol |
| Exact Mass | 542.27 |
| IUPAC Name | O-[2-[(2R,5R,17S,18S,20S)-5-cyclohexyl-20-hydroxy-2,18-dimethyl-8-oxo-4,6-dioxapentacyclo[11.7.0.02,10.03,7.014,18]icosa-3(7),9-dien-17-yl]-2-oxoethyl] propanethioate |
| SMILES | CCC(=S)OCC(=O)[C@H]1CCC2C3CCC4=CC(=O)C5=C(O[C@@H](C6CCCCC6)O5)[C@]4(C)C3C(O)C[C@@]21C |
| InChI | InChI=1S/C31H42O6S/c1-4-25(38)35-16-24(34)21-13-12-20-19-11-10-18-14-22(32)27-28(37-29(36-27)17-8-6-5-7-9-17)31(18,3)26(19)23(33)15-30(20,21)2/h14,17,19-21,23,26,29,33H,4-13,15-16H2,1-3H3/t19?,20?,21-,23?,26?,29+,30+,31+/m1/s1 |
| InChIKey | PKEQQQGMAVBRDK-PYMHAUOZSA-N |
| XLogP | 5.81 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.74 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|