C12H19NO6S2 — CID 91508105
2-[4,4-bis(methylsulfonyl)buta-1,3-dienyl-methylamino]ethyl prop-2-enoate (PubChem CID 91508105) has the molecular formula C12H19NO6S2 and a molecular weight of 337.42 g/mol. Its IUPAC name is 2-[4,4-bis(methylsulfonyl)buta-1,3-dienyl-methylamino]ethyl prop-2-enoate.
| Compound Name | 2-[4,4-bis(methylsulfonyl)buta-1,3-dienyl-methylamino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 91508105 |
| Molecular Formula | C12H19NO6S2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 2-[4,4-bis(methylsulfonyl)buta-1,3-dienyl-methylamino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCN(C)C=CC=C(S(C)(=O)=O)S(C)(=O)=O |
| InChI | InChI=1S/C12H19NO6S2/c1-5-11(14)19-10-9-13(2)8-6-7-12(20(3,15)16)21(4,17)18/h5-8H,1,9-10H2,2-4H3 |
| InChIKey | LERDPEQYOFKJCU-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|