C28H27N5O8 — CID 91510449
2-[[4-[[4-butoxy-6-[4-[(1Z)-2-carboxy-3-hydroxybuta-1,3-dienyl]anilino]-1,3,5-triazin-2-yl]amino]phenyl]methylidene]propanedioic acid (PubChem CID 91510449) has the molecular formula C28H27N5O8 and a molecular weight of 561.55 g/mol. Its IUPAC name is 2-[[4-[[4-butoxy-6-[4-[(1Z)-2-carboxy-3-hydroxybuta-1,3-dienyl]anilino]-1,3,5-triazin-2-yl]amino]phenyl]methylidene]propanedioic acid.
| Compound Name | 2-[[4-[[4-butoxy-6-[4-[(1Z)-2-carboxy-3-hydroxybuta-1,3-dienyl]anilino]-1,3,5-triazin-2-yl]amino]phenyl]methylidene]propanedioic acid |
|---|---|
| PubChem CID | 91510449 |
| Molecular Formula | C28H27N5O8 |
| Molecular Weight | 561.55 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | 2-[[4-[[4-butoxy-6-[4-[(1Z)-2-carboxy-3-hydroxybuta-1,3-dienyl]anilino]-1,3,5-triazin-2-yl]amino]phenyl]methylidene]propanedioic acid |
| SMILES | C=C(O)/C(=C/c1ccc(Nc2nc(Nc3ccc(C=C(C(=O)O)C(=O)O)cc3)nc(OCCCC)n2)cc1)C(=O)O |
| InChI | InChI=1S/C28H27N5O8/c1-3-4-13-41-28-32-26(29-19-9-5-17(6-10-19)14-21(16(2)34)23(35)36)31-27(33-28)30-20-11-7-18(8-12-20)15-22(24(37)38)25(39)40/h5-12,14-15,34H,2-4,13H2,1H3,(H,35,36)(H,37,38)(H,39,40)(H2,29,30,31,32,33)/b21-14- |
| InChIKey | GMODLOPNCHJBMR-STZFKDTASA-N |
| XLogP | 4.63 |
| TPSA | 204.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.55 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|