C26H36N10O2 — CID 110189456
6-butoxy-2-N-[4-[[4-butoxy-6-(prop-2-enylamino)-1,3,5-triazin-2-yl]amino]phenyl]-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine (PubChem CID 110189456) has the molecular formula C26H36N10O2 and a molecular weight of 520.64 g/mol. Its IUPAC name is 6-butoxy-2-N-[4-[[4-butoxy-6-(prop-2-enylamino)-1,3,5-triazin-2-yl]amino]phenyl]-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-butoxy-2-N-[4-[[4-butoxy-6-(prop-2-enylamino)-1,3,5-triazin-2-yl]amino]phenyl]-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 110189456 |
| Molecular Formula | C26H36N10O2 |
| Molecular Weight | 520.64 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | 6-butoxy-2-N-[4-[[4-butoxy-6-(prop-2-enylamino)-1,3,5-triazin-2-yl]amino]phenyl]-4-N-prop-2-enyl-1,3,5-triazine-2,4-diamine |
| SMILES | C=CCNc1nc(Nc2ccc(Nc3nc(NCC=C)nc(OCCCC)n3)cc2)nc(OCCCC)n1 |
| InChI | InChI=1S/C26H36N10O2/c1-5-9-17-37-25-33-21(27-15-7-3)31-23(35-25)29-19-11-13-20(14-12-19)30-24-32-22(28-16-8-4)34-26(36-24)38-18-10-6-2/h7-8,11-14H,3-6,9-10,15-18H2,1-2H3,(H2,27,29,31,33,35)(H2,28,30,32,34,36) |
| InChIKey | HKHQWLFDZHKITJ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 143.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.64 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|