C10H15NO2 — CID 91512803
2,5-dimethyl-4,5,6,7-tetrahydroisoindole-1,3-diol (PubChem CID 91512803) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is 2,5-dimethyl-4,5,6,7-tetrahydroisoindole-1,3-diol.
| Compound Name | 2,5-dimethyl-4,5,6,7-tetrahydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 91512803 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 2,5-dimethyl-4,5,6,7-tetrahydroisoindole-1,3-diol |
| SMILES | CC1CCc2c(c(O)n(C)c2O)C1 |
| InChI | InChI=1S/C10H15NO2/c1-6-3-4-7-8(5-6)10(13)11(2)9(7)12/h6,12-13H,3-5H2,1-2H3 |
| InChIKey | BUVZSTVWYJPMOY-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |