C12H26Si2 — CID 91515903
trimethyl(4-trimethylsilylhexa-2,5-dienyl)silane (PubChem CID 91515903) has the molecular formula C12H26Si2 and a molecular weight of 226.51 g/mol. Its IUPAC name is trimethyl(4-trimethylsilylhexa-2,5-dienyl)silane.
| Compound Name | trimethyl(4-trimethylsilylhexa-2,5-dienyl)silane |
|---|---|
| PubChem CID | 91515903 |
| Molecular Formula | C12H26Si2 |
| Molecular Weight | 226.51 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | trimethyl(4-trimethylsilylhexa-2,5-dienyl)silane |
| SMILES | C=CC(C=CC[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C12H26Si2/c1-8-12(14(5,6)7)10-9-11-13(2,3)4/h8-10,12H,1,11H2,2-7H3 |
| InChIKey | YTDFQUWGCAZFMR-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.51 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|