C12H12O3 — CID 91517697
2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethanone (PubChem CID 91517697) has the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. Its IUPAC name is 2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethanone.
| Compound Name | 2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethanone |
|---|---|
| PubChem CID | 91517697 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 2-cyclohexa-1,3-dien-1-yl-1-(1,4-dioxin-2-yl)ethanone |
| SMILES | O=C(CC1=CC=CCC1)C1=COC=CO1 |
| InChI | InChI=1S/C12H12O3/c13-11(12-9-14-6-7-15-12)8-10-4-2-1-3-5-10/h1-2,4,6-7,9H,3,5,8H2 |
| InChIKey | NALVDMLDRKATOL-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |