C17H19BrO5 — CID 66899312
ethyl (Z)-4-bromo-3-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methoxy]but-2-enoate (PubChem CID 66899312) has the molecular formula C17H19BrO5 and a molecular weight of 383.24 g/mol. Its IUPAC name is ethyl (Z)-4-bromo-3-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methoxy]but-2-enoate.
| Compound Name | ethyl (Z)-4-bromo-3-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methoxy]but-2-enoate |
|---|---|
| PubChem CID | 66899312 |
| Molecular Formula | C17H19BrO5 |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | ethyl (Z)-4-bromo-3-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methoxy]but-2-enoate |
| SMILES | CCOC(=O)/C=C(/CBr)OC(C1=CC=CCC1)C1=COC=CO1 |
| InChI | InChI=1S/C17H19BrO5/c1-2-21-16(19)10-14(11-18)23-17(13-6-4-3-5-7-13)15-12-20-8-9-22-15/h3-4,6,8-10,12,17H,2,5,7,11H2,1H3/b14-10- |
| InChIKey | YXSDEPOBYWDFBP-UVTDQMKNSA-N |
| XLogP | 3.85 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|