C46H48O7 — CID 70872900
[(2R,3R,4S,5S,6S)-6-[3-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-4-ethylphenyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol (PubChem CID 70872900) has the molecular formula C46H48O7 and a molecular weight of 712.88 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-6-[3-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-4-ethylphenyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol.
| Compound Name | [(2R,3R,4S,5S,6S)-6-[3-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-4-ethylphenyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol |
|---|---|
| PubChem CID | 70872900 |
| Molecular Formula | C46H48O7 |
| Molecular Weight | 712.88 g/mol |
| Exact Mass | 712.34 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-6-[3-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-4-ethylphenyl]-3,4,5-tris(phenylmethoxy)oxan-2-yl]methanol |
| SMILES | CCc1ccc([C@@H]2O[C@H](CO)[C@@H](OCc3ccccc3)[C@@H](OCc3ccccc3)C2OCc2ccccc2)cc1C(C1=CC=CCC1)C1=COC=CO1 |
| InChI | InChI=1S/C46H48O7/c1-2-36-23-24-38(27-39(36)42(37-21-13-6-14-22-37)41-32-48-25-26-49-41)43-45(51-30-34-17-9-4-10-18-34)46(52-31-35-19-11-5-12-20-35)44(40(28-47)53-43)50-29-33-15-7-3-8-16-33/h3-13,15-21,23-27,32,40,42-47H,2,14,22,28-31H2,1H3/t40-,42?,43+,44-,45?,46-/m1/s1 |
| InChIKey | SFSKYQLTQCOYCL-XRIHFRFYSA-N |
| XLogP | 9.16 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.88 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |