C16H20N2O3S — CID 91520241
8-(3H-inden-1-ylsulfonyl)-1-oxa-4,8-diazaspiro[4.5]decane (PubChem CID 91520241) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is 8-(3H-inden-1-ylsulfonyl)-1-oxa-4,8-diazaspiro[4.5]decane.
| Compound Name | 8-(3H-inden-1-ylsulfonyl)-1-oxa-4,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 91520241 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 8-(3H-inden-1-ylsulfonyl)-1-oxa-4,8-diazaspiro[4.5]decane |
| SMILES | O=S(=O)(C1=CCc2ccccc21)N1CCC2(CC1)NCCO2 |
| InChI | InChI=1S/C16H20N2O3S/c19-22(20,15-6-5-13-3-1-2-4-14(13)15)18-10-7-16(8-11-18)17-9-12-21-16/h1-4,6,17H,5,7-12H2 |
| InChIKey | WRHAEJJOGNIVDJ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |