C32H38F12O5 — CID 91520243
[3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 2,2-dimethylbutanoate;6-butan-2-ylnaphthalen-2-ol (PubChem CID 91520243) has the molecular formula C32H38F12O5 and a molecular weight of 730.63 g/mol. Its IUPAC name is [3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 2,2-dimethylbutanoate;6-butan-2-ylnaphthalen-2-ol.
| Compound Name | [3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 2,2-dimethylbutanoate;6-butan-2-ylnaphthalen-2-ol |
|---|---|
| PubChem CID | 91520243 |
| Molecular Formula | C32H38F12O5 |
| Molecular Weight | 730.63 g/mol |
| Exact Mass | 730.25 |
| IUPAC Name | [3,5-bis(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)cyclohexyl] 2,2-dimethylbutanoate;6-butan-2-ylnaphthalen-2-ol |
| SMILES | CCC(C)(C)C(=O)OC1CC(C(O)(C(F)(F)F)C(F)(F)F)CC(C(O)(C(F)(F)F)C(F)(F)F)C1.CCC(C)c1ccc2cc(O)ccc2c1 |
| InChI | InChI=1S/C18H22F12O4.C14H16O/c1-4-12(2,3)11(31)34-10-6-8(13(32,15(19,20)21)16(22,23)24)5-9(7-10)14(33,17(25,26)27)18(28,29)30;1-3-10(2)11-4-5-13-9-14(15)7-6-12(13)8-11/h8-10,32-33H,4-7H2,1-3H3;4-10,15H,3H2,1-2H3 |
| InChIKey | RVKPMAKTSLKKBD-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.63 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |