C21H21N7 — CID 91521289
3-methyl-5-[5-(3-phenylpiperazin-1-yl)-1,2,4-triazin-3-yl]-2H-indazole (PubChem CID 91521289) has the molecular formula C21H21N7 and a molecular weight of 371.45 g/mol. Its IUPAC name is 3-methyl-5-[5-(3-phenylpiperazin-1-yl)-1,2,4-triazin-3-yl]-2H-indazole.
| Compound Name | 3-methyl-5-[5-(3-phenylpiperazin-1-yl)-1,2,4-triazin-3-yl]-2H-indazole |
|---|---|
| PubChem CID | 91521289 |
| Molecular Formula | C21H21N7 |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 3-methyl-5-[5-(3-phenylpiperazin-1-yl)-1,2,4-triazin-3-yl]-2H-indazole |
| SMILES | Cc1[nH]nc2ccc(-c3nncc(N4CCNC(c5ccccc5)C4)n3)cc12 |
| InChI | InChI=1S/C21H21N7/c1-14-17-11-16(7-8-18(17)26-25-14)21-24-20(12-23-27-21)28-10-9-22-19(13-28)15-5-3-2-4-6-15/h2-8,11-12,19,22H,9-10,13H2,1H3,(H,25,26) |
| InChIKey | JNKBFAZUFIJDEI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |