C21H20ClN7 — CID 91590115
5-[5-(3-benzylpiperazin-1-yl)-1,2,4-triazin-3-yl]-3-chloro-2H-indazole (PubChem CID 91590115) has the molecular formula C21H20ClN7 and a molecular weight of 405.89 g/mol. Its IUPAC name is 5-[5-(3-benzylpiperazin-1-yl)-1,2,4-triazin-3-yl]-3-chloro-2H-indazole.
| Compound Name | 5-[5-(3-benzylpiperazin-1-yl)-1,2,4-triazin-3-yl]-3-chloro-2H-indazole |
|---|---|
| PubChem CID | 91590115 |
| Molecular Formula | C21H20ClN7 |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 5-[5-(3-benzylpiperazin-1-yl)-1,2,4-triazin-3-yl]-3-chloro-2H-indazole |
| SMILES | Clc1[nH]nc2ccc(-c3nncc(N4CCNC(Cc5ccccc5)C4)n3)cc12 |
| InChI | InChI=1S/C21H20ClN7/c22-20-17-11-15(6-7-18(17)26-27-20)21-25-19(12-24-28-21)29-9-8-23-16(13-29)10-14-4-2-1-3-5-14/h1-7,11-12,16,23H,8-10,13H2,(H,26,27) |
| InChIKey | FYPKSQFXNMITHR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |