About 2-amino-1-(6-methylcyclohexa-2,4-dien-1-yl)propan-1-ol
2-amino-1-(6-methylcyclohexa-2,4-dien-1-yl)propan-1-ol (PubChem CID 91522670) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 2-amino-1-(6-methylcyclohexa-2,4-dien-1-yl)propan-1-ol.
Analyze 2-amino-1-(6-methylcyclohexa-2,4-dien-1-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(6-methylcyclohexa-2,4-dien-1-yl)propan-1-ol?
The IUPAC name of 2-amino-1-(6-methylcyclohexa-2,4-dien-1-yl)propan-1-ol (CID 91522670) is 2-amino-1-(6-methylcyclohexa-2,4-dien-1-yl)propan-1-ol.
What is the SMILES notation for 2-amino-1-(6-methylcyclohexa-2,4-dien-1-yl)propan-1-ol?
The canonical SMILES for 2-amino-1-(6-methylcyclohexa-2,4-dien-1-yl)propan-1-ol is CC(N)C(O)C1C=CC=CC1C.
What is the InChIKey of 2-amino-1-(6-methylcyclohexa-2,4-dien-1-yl)propan-1-ol?
The InChIKey is NAGJGTJZZXJTNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c1-7-5-3-4-6-9(7)10(12)8(2)11/h3-10,12H,11H2,1-2H3.
What are the key properties of 2-amino-1-(6-methylcyclohexa-2,4-dien-1-yl)propan-1-ol?
2-amino-1-(6-methylcyclohexa-2,4-dien-1-yl)propan-1-ol has a molecular weight of 167.25 g/mol, XLogP of 1.07, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(6-methylcyclohexa-2,4-dien-1-yl)propan-1-ol is sourced from PubChem (CID 91522670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).