C31H32ClN3O8 — CID 91523959
7-chloro-4-(dimethylamino)-10,12a-dihydroxy-8-[(5-methoxy-1,3-dihydroisoindol-2-yl)methyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide (PubChem CID 91523959) has the molecular formula C31H32ClN3O8 and a molecular weight of 610.06 g/mol. Its IUPAC name is 7-chloro-4-(dimethylamino)-10,12a-dihydroxy-8-[(5-methoxy-1,3-dihydroisoindol-2-yl)methyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide.
| Compound Name | 7-chloro-4-(dimethylamino)-10,12a-dihydroxy-8-[(5-methoxy-1,3-dihydroisoindol-2-yl)methyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 91523959 |
| Molecular Formula | C31H32ClN3O8 |
| Molecular Weight | 610.06 g/mol |
| Exact Mass | 609.19 |
| IUPAC Name | 7-chloro-4-(dimethylamino)-10,12a-dihydroxy-8-[(5-methoxy-1,3-dihydroisoindol-2-yl)methyl]-1,3,11,12-tetraoxo-4,4a,5,5a,6,11a-hexahydrotetracene-2-carboxamide |
| SMILES | COc1ccc2c(c1)CN(Cc1cc(O)c3c(c1Cl)CC1CC4C(N(C)C)C(=O)C(C(N)=O)C(=O)C4(O)C(=O)C1C3=O)C2 |
| InChI | InChI=1S/C31H32ClN3O8/c1-34(2)25-19-8-14-7-18-22(26(37)21(14)28(39)31(19,42)29(40)23(27(25)38)30(33)41)20(36)9-16(24(18)32)12-35-10-13-4-5-17(43-3)6-15(13)11-35/h4-6,9,14,19,21,23,25,36,42H,7-8,10-12H2,1-3H3,(H2,33,41) |
| InChIKey | NRSXYQQCVDAXKI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 167.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.06 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|